C16H15N3O5S — CID 40953039
3-hydroxy-N'-[(2R)-2-(4-nitrophenyl)sulfanylpropanoyl]benzohydrazide (PubChem CID 40953039) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 3-hydroxy-N'-[(2R)-2-(4-nitrophenyl)sulfanylpropanoyl]benzohydrazide.
| Compound Name | 3-hydroxy-N'-[(2R)-2-(4-nitrophenyl)sulfanylpropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 40953039 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-hydroxy-N'-[(2R)-2-(4-nitrophenyl)sulfanylpropanoyl]benzohydrazide |
| SMILES | C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)NNC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H15N3O5S/c1-10(25-14-7-5-12(6-8-14)19(23)24)15(21)17-18-16(22)11-3-2-4-13(20)9-11/h2-10,20H,1H3,(H,17,21)(H,18,22)/t10-/m1/s1 |
| InChIKey | FJIJAUOGUQYXRM-SNVBAGLBSA-N |
| XLogP | 2.24 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|