C16H23F3N2O3 — CID 86990345
2-(1-adamantyl)-N'-[2-(2,2,2-trifluoroethoxy)acetyl]acetohydrazide (PubChem CID 86990345) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-(1-adamantyl)-N'-[2-(2,2,2-trifluoroethoxy)acetyl]acetohydrazide.
| Compound Name | 2-(1-adamantyl)-N'-[2-(2,2,2-trifluoroethoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 86990345 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(1-adamantyl)-N'-[2-(2,2,2-trifluoroethoxy)acetyl]acetohydrazide |
| SMILES | O=C(COCC(F)(F)F)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H23F3N2O3/c17-16(18,19)9-24-8-14(23)21-20-13(22)7-15-4-10-1-11(5-15)3-12(2-10)6-15/h10-12H,1-9H2,(H,20,22)(H,21,23) |
| InChIKey | QLAIZYYGOKUFHZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|