C17H16F3NO3S — CID 7801075
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-ethyl-5-methylthiophene-2-carboxylate (PubChem CID 7801075) has the molecular formula C17H16F3NO3S and a molecular weight of 371.38 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-ethyl-5-methylthiophene-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-ethyl-5-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 7801075 |
| Molecular Formula | C17H16F3NO3S |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-ethyl-5-methylthiophene-2-carboxylate |
| SMILES | CCc1cc(C(=O)O[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)sc1C |
| InChI | InChI=1S/C17H16F3NO3S/c1-4-10-7-13(25-9(10)3)17(23)24-8(2)16(22)21-12-6-5-11(18)14(19)15(12)20/h5-8H,4H2,1-3H3,(H,21,22)/t8-/m0/s1 |
| InChIKey | COSJUDVRDMMWJL-QMMMGPOBSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|