C16H29NO2 — CID 78011016
15-propyl-1-oxa-4-azacyclopentadec-9-en-5-one (PubChem CID 78011016) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 15-propyl-1-oxa-4-azacyclopentadec-9-en-5-one.
| Compound Name | 15-propyl-1-oxa-4-azacyclopentadec-9-en-5-one |
|---|---|
| PubChem CID | 78011016 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 15-propyl-1-oxa-4-azacyclopentadec-9-en-5-one |
| SMILES | CCCC1CCCCC=CCCCC(=O)NCCO1 |
| InChI | InChI=1S/C16H29NO2/c1-2-10-15-11-8-6-4-3-5-7-9-12-16(18)17-13-14-19-15/h3,5,15H,2,4,6-14H2,1H3,(H,17,18) |
| InChIKey | IPTBVTQALFUWMW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|