C34H32N4O3 — CID 78011226
2-[4-[[5-[1-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 78011226) has the molecular formula C34H32N4O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[4-[[5-[1-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[1-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 78011226 |
| Molecular Formula | C34H32N4O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 2-[4-[[5-[1-(2,3-dihydro-1H-pyrrolo[2,3-b]pyridin-5-yl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)NC(C)c3cnc4c(c3)CCN4)cc12 |
| InChI | InChI=1S/C34H32N4O3/c1-20-22(3)38(19-23-8-10-24(11-9-23)28-6-4-5-7-29(28)34(40)41)31-13-12-26(17-30(20)31)33(39)37-21(2)27-16-25-14-15-35-32(25)36-18-27/h4-13,16-18,21H,14-15,19H2,1-3H3,(H,35,36)(H,37,39)(H,40,41) |
| InChIKey | JQIUCWNEYSVKCT-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|