C22H27NO4 — CID 78011332
(3,9,11-trimethoxy-6-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinolin-12-yl)methanol (PubChem CID 78011332) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (3,9,11-trimethoxy-6-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinolin-12-yl)methanol.
| Compound Name | (3,9,11-trimethoxy-6-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinolin-12-yl)methanol |
|---|---|
| PubChem CID | 78011332 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3,9,11-trimethoxy-6-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[3,2-a]isoquinolin-12-yl)methanol |
| SMILES | COc1ccc2c(c1)CC(C)N1Cc3c(OC)cc(OC)c(CO)c3CC21 |
| InChI | InChI=1S/C22H27NO4/c1-13-7-14-8-15(25-2)5-6-16(14)20-9-17-18(11-23(13)20)21(26-3)10-22(27-4)19(17)12-24/h5-6,8,10,13,20,24H,7,9,11-12H2,1-4H3 |
| InChIKey | MQZYRLVKDKEWQG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |