C20H18F2N2O4 — CID 7801344
(5S)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 7801344) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is (5S)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7801344 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | (5S)-3-[(5-acetyl-2-methoxyphenyl)methyl]-5-(2,5-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(C(C)=O)cc1CN1C(=O)N[C@@](C)(c2cc(F)ccc2F)C1=O |
| InChI | InChI=1S/C20H18F2N2O4/c1-11(25)12-4-7-17(28-3)13(8-12)10-24-18(26)20(2,23-19(24)27)15-9-14(21)5-6-16(15)22/h4-9H,10H2,1-3H3,(H,23,27)/t20-/m0/s1 |
| InChIKey | VJEYZSOGXILBSH-FQEVSTJZSA-N |
| XLogP | 3.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|