C28H32N2O6 — CID 78031206
benzyl 9-[cyclopropyl-(1-methoxy-1-oxopropan-2-yl)oxycarbonylamino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylate (PubChem CID 78031206) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is benzyl 9-[cyclopropyl-(1-methoxy-1-oxopropan-2-yl)oxycarbonylamino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylate.
| Compound Name | benzyl 9-[cyclopropyl-(1-methoxy-1-oxopropan-2-yl)oxycarbonylamino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 78031206 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | benzyl 9-[cyclopropyl-(1-methoxy-1-oxopropan-2-yl)oxycarbonylamino]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinoline-4-carboxylate |
| SMILES | COC(=O)C(C)OC(=O)N(C1CC1)C1c2ccccc2N(C(=O)OCc2ccccc2)C2CCCC21 |
| InChI | InChI=1S/C28H32N2O6/c1-18(26(31)34-2)36-28(33)29(20-15-16-20)25-21-11-6-7-13-23(21)30(24-14-8-12-22(24)25)27(32)35-17-19-9-4-3-5-10-19/h3-7,9-11,13,18,20,22,24-25H,8,12,14-17H2,1-2H3 |
| InChIKey | NKVGNTOFPPHRIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|