C28H32N2O5 — CID 71136472
4-[cyclopropyl-(4-phenylmethoxycarbonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)amino]-2-methyl-4-oxobutanoic acid (PubChem CID 71136472) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is 4-[cyclopropyl-(4-phenylmethoxycarbonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)amino]-2-methyl-4-oxobutanoic acid.
| Compound Name | 4-[cyclopropyl-(4-phenylmethoxycarbonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)amino]-2-methyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71136472 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | 4-[cyclopropyl-(4-phenylmethoxycarbonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)amino]-2-methyl-4-oxobutanoic acid |
| SMILES | CC(CC(=O)N(C1CC1)C1c2ccccc2N(C(=O)OCc2ccccc2)C2CCCC21)C(=O)O |
| InChI | InChI=1S/C28H32N2O5/c1-18(27(32)33)16-25(31)29(20-14-15-20)26-21-10-5-6-12-23(21)30(24-13-7-11-22(24)26)28(34)35-17-19-8-3-2-4-9-19/h2-6,8-10,12,18,20,22,24,26H,7,11,13-17H2,1H3,(H,32,33) |
| InChIKey | IRJLMDCDAHZCBR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |