C26H26F2N2O4 — CID 71136481
4-[cyclopropyl-[4-(3,5-difluorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid (PubChem CID 71136481) has the molecular formula C26H26F2N2O4 and a molecular weight of 468.50 g/mol. Its IUPAC name is 4-[cyclopropyl-[4-(3,5-difluorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[cyclopropyl-[4-(3,5-difluorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71136481 |
| Molecular Formula | C26H26F2N2O4 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 4-[cyclopropyl-[4-(3,5-difluorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CC1)C1c2ccccc2N(C(=O)c2cc(F)cc(F)c2)C2CCCC21 |
| InChI | InChI=1S/C26H26F2N2O4/c27-16-12-15(13-17(28)14-16)26(34)30-21-6-2-1-4-19(21)25(20-5-3-7-22(20)30)29(18-8-9-18)23(31)10-11-24(32)33/h1-2,4,6,12-14,18,20,22,25H,3,5,7-11H2,(H,32,33) |
| InChIKey | MVKOSXDTHQRUCV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |