C27H27F3N2O4S — CID 71139284
4-[[(3aS,9R,9aR)-4-[4-(trifluoromethylsulfanyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid (PubChem CID 71139284) has the molecular formula C27H27F3N2O4S and a molecular weight of 532.58 g/mol. Its IUPAC name is 4-[[(3aS,9R,9aR)-4-[4-(trifluoromethylsulfanyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aS,9R,9aR)-4-[4-(trifluoromethylsulfanyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71139284 |
| Molecular Formula | C27H27F3N2O4S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 4-[[(3aS,9R,9aR)-4-[4-(trifluoromethylsulfanyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CC1)[C@H]1c2ccccc2N(C(=O)c2ccc(SC(F)(F)F)cc2)[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C27H27F3N2O4S/c28-27(29,30)37-18-12-8-16(9-13-18)26(36)32-21-6-2-1-4-19(21)25(20-5-3-7-22(20)32)31(17-10-11-17)23(33)14-15-24(34)35/h1-2,4,6,8-9,12-13,17,20,22,25H,3,5,7,10-11,14-15H2,(H,34,35)/t20-,22+,25+/m1/s1 |
| InChIKey | SQAIDQPZIZGQRT-KJWPAHLWSA-N |
| XLogP | 6.02 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |