C28H29F3N2O5 — CID 71139725
4-[[(3aR,9R,9aS)-4-[3-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclobutylamino]-4-oxobutanoic acid (PubChem CID 71139725) has the molecular formula C28H29F3N2O5 and a molecular weight of 530.54 g/mol. Its IUPAC name is 4-[[(3aR,9R,9aS)-4-[3-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclobutylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aR,9R,9aS)-4-[3-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclobutylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71139725 |
| Molecular Formula | C28H29F3N2O5 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 4-[[(3aR,9R,9aS)-4-[3-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclobutylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CCC1)[C@H]1c2ccccc2N(C(=O)c2cccc(OC(F)(F)F)c2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C28H29F3N2O5/c29-28(30,31)38-19-9-3-6-17(16-19)27(37)33-22-12-2-1-10-20(22)26(21-11-5-13-23(21)33)32(18-7-4-8-18)24(34)14-15-25(35)36/h1-3,6,9-10,12,16,18,21,23,26H,4-5,7-8,11,13-15H2,(H,35,36)/t21-,23+,26-/m0/s1 |
| InChIKey | VTCQZXVECDCEIH-SYVJQLTCSA-N |
| XLogP | 5.70 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |