C25H27N3O4 — CID 71140088
4-[[(3aR,9R,9aS)-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid (PubChem CID 71140088) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[[(3aR,9R,9aS)-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aR,9R,9aS)-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71140088 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 4-[[(3aR,9R,9aS)-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CC1)[C@H]1c2ccccc2N(C(=O)c2cccnc2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C25H27N3O4/c29-22(12-13-23(30)31)27(17-10-11-17)24-18-6-1-2-8-20(18)28(21-9-3-7-19(21)24)25(32)16-5-4-14-26-15-16/h1-2,4-6,8,14-15,17,19,21,24H,3,7,9-13H2,(H,30,31)/t19-,21+,24-/m0/s1 |
| InChIKey | GMFXPJTZXJOOME-LEEZEASISA-N |
| XLogP | 3.81 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |