C27H29ClN2O4 — CID 71139700
methyl 4-[[(3aR,9R,9aS)-4-(4-chlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoate (PubChem CID 71139700) has the molecular formula C27H29ClN2O4 and a molecular weight of 480.99 g/mol. Its IUPAC name is methyl 4-[[(3aR,9R,9aS)-4-(4-chlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[(3aR,9R,9aS)-4-(4-chlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 71139700 |
| Molecular Formula | C27H29ClN2O4 |
| Molecular Weight | 480.99 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | methyl 4-[[(3aR,9R,9aS)-4-(4-chlorobenzoyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C1CC1)[C@H]1c2ccccc2N(C(=O)c2ccc(Cl)cc2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C27H29ClN2O4/c1-34-25(32)16-15-24(31)29(19-13-14-19)26-20-5-2-3-7-22(20)30(23-8-4-6-21(23)26)27(33)17-9-11-18(28)12-10-17/h2-3,5,7,9-12,19,21,23,26H,4,6,8,13-16H2,1H3/t21-,23+,26-/m0/s1 |
| InChIKey | GXPVXNHMZNCZDH-SYVJQLTCSA-N |
| XLogP | 5.15 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.99 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |