C35H39N3O5 — CID 123595773
4-[cyclopropyl-[4-[4-(5-ethoxy-3-ethyl-2-pyridinyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid (PubChem CID 123595773) has the molecular formula C35H39N3O5 and a molecular weight of 581.71 g/mol. Its IUPAC name is 4-[cyclopropyl-[4-[4-(5-ethoxy-3-ethyl-2-pyridinyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[cyclopropyl-[4-[4-(5-ethoxy-3-ethyl-2-pyridinyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123595773 |
| Molecular Formula | C35H39N3O5 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | 4-[cyclopropyl-[4-[4-(5-ethoxy-3-ethyl-2-pyridinyl)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
| SMILES | CCOc1cnc(-c2ccc(C(=O)N3c4ccccc4C(N(C(=O)CCC(=O)O)C4CC4)C4CCCC43)cc2)c(CC)c1 |
| InChI | InChI=1S/C35H39N3O5/c1-3-22-20-26(43-4-2)21-36-33(22)23-12-14-24(15-13-23)35(42)38-29-10-6-5-8-27(29)34(28-9-7-11-30(28)38)37(25-16-17-25)31(39)18-19-32(40)41/h5-6,8,10,12-15,20-21,25,28,30,34H,3-4,7,9,11,16-19H2,1-2H3,(H,40,41) |
| InChIKey | ZMEANIGNPPUFRV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |