C26H27F3N2O5 — CID 71140277
methyl 4-[[(3aR,9R,9aS)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-4-oxobutanoate (PubChem CID 71140277) has the molecular formula C26H27F3N2O5 and a molecular weight of 504.51 g/mol. Its IUPAC name is methyl 4-[[(3aR,9R,9aS)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[(3aR,9R,9aS)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 71140277 |
| Molecular Formula | C26H27F3N2O5 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | methyl 4-[[(3aR,9R,9aS)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-methylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C)[C@H]1c2ccccc2N(C(=O)c2ccc(OC(F)(F)F)cc2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C26H27F3N2O5/c1-30(22(32)14-15-23(33)35-2)24-18-6-3-4-8-20(18)31(21-9-5-7-19(21)24)25(34)16-10-12-17(13-11-16)36-26(27,28)29/h3-4,6,8,10-13,19,21,24H,5,7,9,14-15H2,1-2H3/t19-,21+,24-/m0/s1 |
| InChIKey | FSKWXNDHOSPLOA-LEEZEASISA-N |
| XLogP | 4.87 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |