C30H31F5N2O5 — CID 71135147
ethyl 4-[cyclopropyl-[7-(difluoromethyl)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate (PubChem CID 71135147) has the molecular formula C30H31F5N2O5 and a molecular weight of 594.58 g/mol. Its IUPAC name is ethyl 4-[cyclopropyl-[7-(difluoromethyl)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[cyclopropyl-[7-(difluoromethyl)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 71135147 |
| Molecular Formula | C30H31F5N2O5 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | ethyl 4-[cyclopropyl-[7-(difluoromethyl)-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(C1CC1)C1c2cc(C(F)F)ccc2N(C(=O)c2ccc(OC(F)(F)F)cc2)C2CCCC21 |
| InChI | InChI=1S/C30H31F5N2O5/c1-2-41-26(39)15-14-25(38)36(19-9-10-19)27-21-4-3-5-23(21)37(24-13-8-18(28(31)32)16-22(24)27)29(40)17-6-11-20(12-7-17)42-30(33,34)35/h6-8,11-13,16,19,21,23,27-28H,2-5,9-10,14-15H2,1H3 |
| InChIKey | UWMHFTFWDRNFBM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |