C27H28F4N2O5 — CID 162565896
4-[[(3aS,9R,9aR)-7-fluoro-4-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid (PubChem CID 162565896) has the molecular formula C27H28F4N2O5 and a molecular weight of 536.52 g/mol. Its IUPAC name is 4-[[(3aS,9R,9aR)-7-fluoro-4-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aS,9R,9aR)-7-fluoro-4-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 162565896 |
| Molecular Formula | C27H28F4N2O5 |
| Molecular Weight | 536.52 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 4-[[(3aS,9R,9aR)-7-fluoro-4-[hydroxy-[4-(trifluoromethoxy)phenyl]methyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CC1)[C@H]1c2cc(F)ccc2N(C(O)c2ccc(OC(F)(F)F)cc2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C27H28F4N2O5/c28-16-6-11-22-20(14-16)25(32(17-7-8-17)23(34)12-13-24(35)36)19-2-1-3-21(19)33(22)26(37)15-4-9-18(10-5-15)38-27(29,30)31/h4-6,9-11,14,17,19,21,25-26,37H,1-3,7-8,12-13H2,(H,35,36)/t19-,21+,25-,26?/m1/s1 |
| InChIKey | UFWRTIQERHEYRS-APXIWZAXSA-N |
| XLogP | 5.30 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |