C26H27F3N2O6S — CID 71136112
4-[cyclopropyl-[4-[4-(trifluoromethoxy)phenyl]sulfonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid (PubChem CID 71136112) has the molecular formula C26H27F3N2O6S and a molecular weight of 552.57 g/mol. Its IUPAC name is 4-[cyclopropyl-[4-[4-(trifluoromethoxy)phenyl]sulfonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[cyclopropyl-[4-[4-(trifluoromethoxy)phenyl]sulfonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71136112 |
| Molecular Formula | C26H27F3N2O6S |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 4-[cyclopropyl-[4-[4-(trifluoromethoxy)phenyl]sulfonyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CC1)C1c2ccccc2N(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)C2CCCC12 |
| InChI | InChI=1S/C26H27F3N2O6S/c27-26(28,29)37-17-10-12-18(13-11-17)38(35,36)31-21-6-2-1-4-19(21)25(20-5-3-7-22(20)31)30(16-8-9-16)23(32)14-15-24(33)34/h1-2,4,6,10-13,16,20,22,25H,3,5,7-9,14-15H2,(H,33,34) |
| InChIKey | LXEBKOWMUVXHOA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |