C35H36F2N2O5 — CID 123230163
4-[cyclopropyl-[7-(4-fluorophenyl)-4-[4-(2-fluoropropan-2-yloxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid (PubChem CID 123230163) has the molecular formula C35H36F2N2O5 and a molecular weight of 602.68 g/mol. Its IUPAC name is 4-[cyclopropyl-[7-(4-fluorophenyl)-4-[4-(2-fluoropropan-2-yloxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[cyclopropyl-[7-(4-fluorophenyl)-4-[4-(2-fluoropropan-2-yloxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123230163 |
| Molecular Formula | C35H36F2N2O5 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | 4-[cyclopropyl-[7-(4-fluorophenyl)-4-[4-(2-fluoropropan-2-yloxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)(F)Oc1ccc(C(=O)N2c3ccc(-c4ccc(F)cc4)cc3C(N(C(=O)CCC(=O)O)C3CC3)C3CCCC32)cc1 |
| InChI | InChI=1S/C35H36F2N2O5/c1-35(2,37)44-26-15-8-22(9-16-26)34(43)39-29-5-3-4-27(29)33(38(25-13-14-25)31(40)18-19-32(41)42)28-20-23(10-17-30(28)39)21-6-11-24(36)12-7-21/h6-12,15-17,20,25,27,29,33H,3-5,13-14,18-19H2,1-2H3,(H,41,42) |
| InChIKey | PWVDTXNJPXICJP-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |