C30H31F3N2O6 — CID 89304490
ethyl 4-[cyclopropyl-[7-formyl-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate (PubChem CID 89304490) has the molecular formula C30H31F3N2O6 and a molecular weight of 572.58 g/mol. Its IUPAC name is ethyl 4-[cyclopropyl-[7-formyl-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[cyclopropyl-[7-formyl-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 89304490 |
| Molecular Formula | C30H31F3N2O6 |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | ethyl 4-[cyclopropyl-[7-formyl-4-[4-(trifluoromethoxy)benzoyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(C1CC1)C1c2cc(C=O)ccc2N(C(=O)c2ccc(OC(F)(F)F)cc2)C2CCCC21 |
| InChI | InChI=1S/C30H31F3N2O6/c1-2-40-27(38)15-14-26(37)34(20-9-10-20)28-22-4-3-5-24(22)35(25-13-6-18(17-36)16-23(25)28)29(39)19-7-11-21(12-8-19)41-30(31,32)33/h6-8,11-13,16-17,20,22,24,28H,2-5,9-10,14-15H2,1H3 |
| InChIKey | XXYISJBBDHHMCQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|