About [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate
[(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate (PubChem CID 7803493) has the molecular formula C19H22FNO4S
and a molecular weight of 379.45 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
Molecular Properties
| Compound Name | [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| PubChem CID | 7803493 |
| Molecular Formula | C19H22FNO4S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)O[C@H](C)c2ccccc2)c1 |
| InChI | InChI=1S/C19H22FNO4S/c1-4-21(5-2)26(23,24)16-11-12-18(20)17(13-16)19(22)25-14(3)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3/t14-/m1/s1 |
| InChIKey | MQFWLQRJZZSIRN-CQSZACIVSA-N |
| XLogP | 3.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate?
The IUPAC name of [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate (CID 7803493) is [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate.
What is the SMILES notation for [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate?
The canonical SMILES for [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate is CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)O[C@H](C)c2ccccc2)c1.
What is the InChIKey of [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate?
The InChIKey is MQFWLQRJZZSIRN-CQSZACIVSA-N. The full InChI is InChI=1S/C19H22FNO4S/c1-4-21(5-2)26(23,24)16-11-12-18(20)17(13-16)19(22)25-14(3)15-9-7-6-8-10-15/h6-14H,4-5H2,1-3H3/t14-/m1/s1.
What are the key properties of [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate?
[(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate has a molecular weight of 379.45 g/mol, XLogP of 3.77, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-phenylethyl] 5-(diethylsulfamoyl)-2-fluorobenzoate is sourced from PubChem (CID 7803493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).