C14H21F2NO2S — CID 78056402
N-[3-fluoro-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 78056402) has the molecular formula C14H21F2NO2S and a molecular weight of 305.39 g/mol. Its IUPAC name is N-[3-fluoro-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[3-fluoro-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 78056402 |
| Molecular Formula | C14H21F2NO2S |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[3-fluoro-2-(2-fluorophenyl)-4-hydroxybutan-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(NS(=O)C(C)(C)C)(c1ccccc1F)C(F)CO |
| InChI | InChI=1S/C14H21F2NO2S/c1-13(2,3)20(19)17-14(4,12(16)9-18)10-7-5-6-8-11(10)15/h5-8,12,17-18H,9H2,1-4H3 |
| InChIKey | PQOXGDYWOZAVMW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |