C24H24N4O2S — CID 78056448
6-[3-[4-(1,3-benzothiazol-2-ylmethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one (PubChem CID 78056448) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 6-[3-[4-(1,3-benzothiazol-2-ylmethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one.
| Compound Name | 6-[3-[4-(1,3-benzothiazol-2-ylmethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 78056448 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 6-[3-[4-(1,3-benzothiazol-2-ylmethyl)piperidin-1-yl]-3-oxoprop-1-enyl]-3,4-dihydro-1H-1,8-naphthyridin-2-one |
| SMILES | O=C1CCc2cc(C=CC(=O)N3CCC(Cc4nc5ccccc5s4)CC3)cnc2N1 |
| InChI | InChI=1S/C24H24N4O2S/c29-21-7-6-18-13-17(15-25-24(18)27-21)5-8-23(30)28-11-9-16(10-12-28)14-22-26-19-3-1-2-4-20(19)31-22/h1-5,8,13,15-16H,6-7,9-12,14H2,(H,25,27,29) |
| InChIKey | NBUJSSROUNEIJV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|