C17H18N4O3S — CID 7805854
[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 1-ethylbenzotriazole-5-carboxylate (PubChem CID 7805854) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 1-ethylbenzotriazole-5-carboxylate.
| Compound Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 1-ethylbenzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 7805854 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 1-ethylbenzotriazole-5-carboxylate |
| SMILES | CCn1nnc2cc(C(=O)OCC(=O)N[C@H](C)c3cccs3)ccc21 |
| InChI | InChI=1S/C17H18N4O3S/c1-3-21-14-7-6-12(9-13(14)19-20-21)17(23)24-10-16(22)18-11(2)15-5-4-8-25-15/h4-9,11H,3,10H2,1-2H3,(H,18,22)/t11-/m1/s1 |
| InChIKey | OMYTWVOWTXBKPX-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |