About Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane
Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane (PubChem CID 78060478) has the molecular formula C10H22Cl3Si2
and a molecular weight of 304.82 g/mol.
Molecular Properties
| Compound Name | Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane |
| PubChem CID | 78060478 |
| Molecular Formula | C10H22Cl3Si2 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | — |
| SMILES | CCCC[Si](Cl)(Cl)CCC[Si](C)CCCl |
| InChI | InChI=1S/C10H22Cl3Si2/c1-3-4-9-15(12,13)10-5-7-14(2)8-6-11/h3-10H2,1-2H3 |
| InChIKey | WIOQCMOKQUNHFT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane?
The IUPAC name of Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane (CID 78060478) is not available.
What is the SMILES notation for Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane?
The canonical SMILES for Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane is CCCC[Si](Cl)(Cl)CCC[Si](C)CCCl.
What is the InChIKey of Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane?
The InChIKey is WIOQCMOKQUNHFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22Cl3Si2/c1-3-4-9-15(12,13)10-5-7-14(2)8-6-11/h3-10H2,1-2H3.
What are the key properties of Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane?
Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane has a molecular weight of 304.82 g/mol, XLogP of 5.46, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Butyl(dichloro){3-[(2-chloroethyl)(methyl)silyl]propyl}silane is sourced from PubChem (CID 78060478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).