C25H46FN4O9PS — CID 78060673
2-[2-[2-[2-[ethoxy(fluoro)phosphoryl]ethoxy]ethoxy]ethoxy]ethyl N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]carbamate (PubChem CID 78060673) has the molecular formula C25H46FN4O9PS and a molecular weight of 628.70 g/mol. Its IUPAC name is 2-[2-[2-[2-[ethoxy(fluoro)phosphoryl]ethoxy]ethoxy]ethoxy]ethyl N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]carbamate.
| Compound Name | 2-[2-[2-[2-[ethoxy(fluoro)phosphoryl]ethoxy]ethoxy]ethoxy]ethyl N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]carbamate |
|---|---|
| PubChem CID | 78060673 |
| Molecular Formula | C25H46FN4O9PS |
| Molecular Weight | 628.70 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 2-[2-[2-[2-[ethoxy(fluoro)phosphoryl]ethoxy]ethoxy]ethoxy]ethyl N-[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]butyl]carbamate |
| SMILES | CCOP(=O)(F)CCOCCOCCOCCOC(=O)NCCCCNC(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C25H46FN4O9PS/c1-2-39-40(26,34)18-17-37-14-13-35-11-12-36-15-16-38-25(33)28-10-6-5-9-27-22(31)8-4-3-7-21-23-20(19-41-21)29-24(32)30-23/h20-21,23H,2-19H2,1H3,(H,27,31)(H,28,33)(H2,29,30,32)/t20-,21-,23-,40?/m0/s1 |
| InChIKey | IHYVIXIFZOANCD-CLBRSFTRSA-N |
| XLogP | 2.58 |
| TPSA | 162.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|