C6H14Cl2N2Si — CID 78067924
N~1~-{3-[(Dichloromethyl)silyl]propyl}ethane-1,2-diamine (PubChem CID 78067924) has the molecular formula C6H14Cl2N2Si and a molecular weight of 213.18 g/mol.
| Compound Name | N~1~-{3-[(Dichloromethyl)silyl]propyl}ethane-1,2-diamine |
|---|---|
| PubChem CID | 78067924 |
| Molecular Formula | C6H14Cl2N2Si |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | — |
| SMILES | NCCNCCC[Si]C(Cl)Cl |
| InChI | InChI=1S/C6H14Cl2N2Si/c7-6(8)11-5-1-3-10-4-2-9/h6,10H,1-5,9H2 |
| InChIKey | HYZJDTPFYNDPQG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|