About 2-phenylmethoxypropanoyl fluoride
2-phenylmethoxypropanoyl fluoride (PubChem CID 78068195) has the molecular formula C10H11FO2
and a molecular weight of 182.19 g/mol. Its IUPAC name is 2-phenylmethoxypropanoyl fluoride.
Molecular Properties
| Compound Name | 2-phenylmethoxypropanoyl fluoride |
| PubChem CID | 78068195 |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-phenylmethoxypropanoyl fluoride |
| SMILES | CC(OCc1ccccc1)C(=O)F |
| InChI | InChI=1S/C10H11FO2/c1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | DCWGHGFMECAPFO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylmethoxypropanoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylmethoxypropanoyl fluoride?
The IUPAC name of 2-phenylmethoxypropanoyl fluoride (CID 78068195) is 2-phenylmethoxypropanoyl fluoride.
What is the SMILES notation for 2-phenylmethoxypropanoyl fluoride?
The canonical SMILES for 2-phenylmethoxypropanoyl fluoride is CC(OCc1ccccc1)C(=O)F.
What is the InChIKey of 2-phenylmethoxypropanoyl fluoride?
The InChIKey is DCWGHGFMECAPFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO2/c1-8(10(11)12)13-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3.
What are the key properties of 2-phenylmethoxypropanoyl fluoride?
2-phenylmethoxypropanoyl fluoride has a molecular weight of 182.19 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylmethoxypropanoyl fluoride is sourced from PubChem (CID 78068195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).