C22H17NO7 — CID 78071580
9-(1,3-benzodioxol-5-yl)-4-methoxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxole-5-carbonitrile (PubChem CID 78071580) has the molecular formula C22H17NO7 and a molecular weight of 407.38 g/mol. Its IUPAC name is 9-(1,3-benzodioxol-5-yl)-4-methoxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxole-5-carbonitrile.
| Compound Name | 9-(1,3-benzodioxol-5-yl)-4-methoxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxole-5-carbonitrile |
|---|---|
| PubChem CID | 78071580 |
| Molecular Formula | C22H17NO7 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 9-(1,3-benzodioxol-5-yl)-4-methoxy-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxole-5-carbonitrile |
| SMILES | COc1c2c(cc3c1C(C#N)C1COC(=O)C1C3c1ccc3c(c1)OCO3)OCO2 |
| InChI | InChI=1S/C22H17NO7/c1-25-21-18-11(5-16-20(21)30-9-29-16)17(10-2-3-14-15(4-10)28-8-27-14)19-13(12(18)6-23)7-26-22(19)24/h2-5,12-13,17,19H,7-9H2,1H3 |
| InChIKey | BLNRXJFJIJOONY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |