C13H13N7O4 — CID 78075612
N'-(4-diazonio-1,3-dimethylpyrazol-5-yl)-N-(4-methoxy-2-nitrophenyl)carbamimidate (PubChem CID 78075612) has the molecular formula C13H13N7O4 and a molecular weight of 331.29 g/mol. Its IUPAC name is N'-(4-diazonio-1,3-dimethylpyrazol-5-yl)-N-(4-methoxy-2-nitrophenyl)carbamimidate.
| Compound Name | N'-(4-diazonio-1,3-dimethylpyrazol-5-yl)-N-(4-methoxy-2-nitrophenyl)carbamimidate |
|---|---|
| PubChem CID | 78075612 |
| Molecular Formula | C13H13N7O4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N'-(4-diazonio-1,3-dimethylpyrazol-5-yl)-N-(4-methoxy-2-nitrophenyl)carbamimidate |
| SMILES | COc1ccc(NC([O-])=Nc2c([N+]#N)c(C)nn2C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H13N7O4/c1-7-11(17-14)12(19(2)18-7)16-13(21)15-9-5-4-8(24-3)6-10(9)20(22)23/h4-6H,1-3H3,(H-,15,16,18,21) |
| InChIKey | RUNORJHPCOYOBU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 145.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|