C20H20O7 — CID 78088743
3,5-dihydroxy-7-(4-hydroxy-3-methylbut-2-enoxy)-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one (PubChem CID 78088743) has the molecular formula C20H20O7 and a molecular weight of 372.37 g/mol. Its IUPAC name is 3,5-dihydroxy-7-(4-hydroxy-3-methylbut-2-enoxy)-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one.
| Compound Name | 3,5-dihydroxy-7-(4-hydroxy-3-methylbut-2-enoxy)-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 78088743 |
| Molecular Formula | C20H20O7 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3,5-dihydroxy-7-(4-hydroxy-3-methylbut-2-enoxy)-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| SMILES | CC(=CCOc1cc(O)c2c(c1)OC(c1ccc(O)cc1)C(O)C2=O)CO |
| InChI | InChI=1S/C20H20O7/c1-11(10-21)6-7-26-14-8-15(23)17-16(9-14)27-20(19(25)18(17)24)12-2-4-13(22)5-3-12/h2-6,8-9,19-23,25H,7,10H2,1H3 |
| InChIKey | MSWOYPGTQZJKQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|