C16H14ClF2N3O5 — CID 7809896
[2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 7809896) has the molecular formula C16H14ClF2N3O5 and a molecular weight of 401.75 g/mol. Its IUPAC name is [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 7809896 |
| Molecular Formula | C16H14ClF2N3O5 |
| Molecular Weight | 401.75 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | CCCn1c(N)c(C(=O)COC(=O)c2cc(F)c(F)cc2Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H14ClF2N3O5/c1-2-3-22-13(20)12(14(24)21-16(22)26)11(23)6-27-15(25)7-4-9(18)10(19)5-8(7)17/h4-5H,2-3,6,20H2,1H3,(H,21,24,26) |
| InChIKey | YOGLURNECNRJQH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.75 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|