C18H18FN3O5 — CID 7970615
[2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate (PubChem CID 7970615) has the molecular formula C18H18FN3O5 and a molecular weight of 375.36 g/mol. Its IUPAC name is [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7970615 |
| Molecular Formula | C18H18FN3O5 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-(2-fluorophenyl)prop-2-enoate |
| SMILES | CCCn1c(N)c(C(=O)COC(=O)/C=C/c2ccccc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H18FN3O5/c1-2-9-22-16(20)15(17(25)21-18(22)26)13(23)10-27-14(24)8-7-11-5-3-4-6-12(11)19/h3-8H,2,9-10,20H2,1H3,(H,21,25,26)/b8-7+ |
| InChIKey | XBXNRQVMKNAVEB-BQYQJAHWSA-N |
| XLogP | 1.11 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|