C21H20N4O5 — CID 16617809
[2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16617809) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16617809 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [2-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-2-oxoethyl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | CCCn1c(N)c(C(=O)COC(=O)/C=C/c2cccc3cccnc23)c(=O)[nH]c1=O |
| InChI | InChI=1S/C21H20N4O5/c1-2-11-25-19(22)17(20(28)24-21(25)29)15(26)12-30-16(27)9-8-14-6-3-5-13-7-4-10-23-18(13)14/h3-10H,2,11-12,22H2,1H3,(H,24,28,29)/b9-8+ |
| InChIKey | MIQXSPAWHHIXQN-CMDGGOBGSA-N |
| XLogP | 1.52 |
| TPSA | 137.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|