C39H62O10 — CID 78106013
[7-acetyloxy-17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxyoxolan-3-yl]-1-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-yl] hexanoate (PubChem CID 78106013) has the molecular formula C39H62O10 and a molecular weight of 690.91 g/mol. Its IUPAC name is [7-acetyloxy-17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxyoxolan-3-yl]-1-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-yl] hexanoate.
| Compound Name | [7-acetyloxy-17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxyoxolan-3-yl]-1-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-yl] hexanoate |
|---|---|
| PubChem CID | 78106013 |
| Molecular Formula | C39H62O10 |
| Molecular Weight | 690.91 g/mol |
| Exact Mass | 690.43 |
| IUPAC Name | [7-acetyloxy-17-[5-(1,2-dihydroxy-2-methylpropyl)-2-methoxyoxolan-3-yl]-1-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-11-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1CC2(C)C(=CCC2C2CC(C(O)C(C)(C)O)OC2OC)C2(C)C(OC(C)=O)CC3C(C)(C)C(=O)CC(O)C3(C)C12 |
| InChI | InChI=1S/C39H62O10/c1-11-12-13-14-31(43)48-25-20-37(7)23(22-17-24(49-34(22)46-10)33(44)36(5,6)45)15-16-26(37)39(9)30(47-21(2)40)18-27-35(3,4)28(41)19-29(42)38(27,8)32(25)39/h16,22-25,27,29-30,32-34,42,44-45H,11-15,17-20H2,1-10H3 |
| InChIKey | JEJMRHFAAVVELE-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.91 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|