C21H24O6 — CID 7810802
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2,4,5-trimethoxybenzoate (PubChem CID 7810802) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2,4,5-trimethoxybenzoate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 7810802 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2,4,5-trimethoxybenzoate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C21H24O6/c1-6-14-7-9-15(10-8-14)20(22)13(2)27-21(23)16-11-18(25-4)19(26-5)12-17(16)24-3/h7-13H,6H2,1-5H3/t13-/m1/s1 |
| InChIKey | VZXPWJUBIZITCF-CYBMUJFWSA-N |
| XLogP | 3.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |