C41H76N2O — CID 78109585
2-(dimethylamino)-N-heptatriaconta-6,9,28,31-tetraen-19-ylacetamide (PubChem CID 78109585) has the molecular formula C41H76N2O and a molecular weight of 613.07 g/mol. Its IUPAC name is 2-(dimethylamino)-N-heptatriaconta-6,9,28,31-tetraen-19-ylacetamide.
| Compound Name | 2-(dimethylamino)-N-heptatriaconta-6,9,28,31-tetraen-19-ylacetamide |
|---|---|
| PubChem CID | 78109585 |
| Molecular Formula | C41H76N2O |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.60 |
| IUPAC Name | 2-(dimethylamino)-N-heptatriaconta-6,9,28,31-tetraen-19-ylacetamide |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CCC=CCCCCC)NC(=O)CN(C)C |
| InChI | InChI=1S/C41H76N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-40(42-41(44)39-43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,40H,5-12,17-18,23-39H2,1-4H3,(H,42,44) |
| InChIKey | PRFMJJJHANAIMD-UHFFFAOYSA-N |
| XLogP | 12.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 12.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|