C15H17N3O6 — CID 7811577
[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2R)-5-oxopyrrolidine-2-carboxylate (PubChem CID 7811577) has the molecular formula C15H17N3O6 and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2R)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2R)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 7811577 |
| Molecular Formula | C15H17N3O6 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl] (2R)-5-oxopyrrolidine-2-carboxylate |
| SMILES | Cc1cc(NC(=O)COC(=O)[C@H]2CCC(=O)N2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H17N3O6/c1-8-5-11(12(18(22)23)6-9(8)2)17-14(20)7-24-15(21)10-3-4-13(19)16-10/h5-6,10H,3-4,7H2,1-2H3,(H,16,19)(H,17,20)/t10-/m1/s1 |
| InChIKey | CKIXNNLLBYULIX-SNVBAGLBSA-N |
| XLogP | 0.97 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|