C33H54O6 — CID 78118151
2-[(4a,6a,7-trimethyl-10-propan-2-yl-2,3,4,4b,5,6,6b,7,8,9,10,10a,11,11a,11b,12-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 78118151) has the molecular formula C33H54O6 and a molecular weight of 546.79 g/mol. Its IUPAC name is 2-[(4a,6a,7-trimethyl-10-propan-2-yl-2,3,4,4b,5,6,6b,7,8,9,10,10a,11,11a,11b,12-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[(4a,6a,7-trimethyl-10-propan-2-yl-2,3,4,4b,5,6,6b,7,8,9,10,10a,11,11a,11b,12-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 78118151 |
| Molecular Formula | C33H54O6 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | 2-[(4a,6a,7-trimethyl-10-propan-2-yl-2,3,4,4b,5,6,6b,7,8,9,10,10a,11,11a,11b,12-hexadecahydro-1H-indeno[2,1-a]phenanthren-2-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)C1CCC(C)C2C1CC1C3CC=C4CC(OC5OC(CO)C(O)C(O)C5O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C33H54O6/c1-17(2)21-8-6-18(3)27-23(21)15-25-22-9-7-19-14-20(10-12-32(19,4)24(22)11-13-33(25,27)5)38-31-30(37)29(36)28(35)26(16-34)39-31/h7,17-18,20-31,34-37H,6,8-16H2,1-5H3 |
| InChIKey | AKIYANINFFCMFR-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|