C32H30F2N4O7 — CID 78118480
N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-ethoxyethyl)-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide (PubChem CID 78118480) has the molecular formula C32H30F2N4O7 and a molecular weight of 620.61 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-ethoxyethyl)-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-ethoxyethyl)-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 78118480 |
| Molecular Formula | C32H30F2N4O7 |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-(2-ethoxyethyl)-3-(4-fluorophenyl)-2,4-dioxo-1,3-diazinane-5-carboxamide |
| SMILES | CCOCCN1CC(C(=O)Nc2ccc(Oc3ccnc4cc(OC)c(OC)cc34)c(F)c2)C(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C32H30F2N4O7/c1-4-44-14-13-37-18-23(31(40)38(32(37)41)21-8-5-19(33)6-9-21)30(39)36-20-7-10-27(24(34)15-20)45-26-11-12-35-25-17-29(43-3)28(42-2)16-22(25)26/h5-12,15-17,23H,4,13-14,18H2,1-3H3,(H,36,39) |
| InChIKey | HJVVEVUCVWJOKB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|