C17H25N3O — CID 7812433
N-[3-[(Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-C-methylcarbonimidoyl]phenyl]acetamide (PubChem CID 7812433) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-[3-[(Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-C-methylcarbonimidoyl]phenyl]acetamide.
| Compound Name | N-[3-[(Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-C-methylcarbonimidoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 7812433 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-[3-[(Z)-N-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-C-methylcarbonimidoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(/C(C)=N\N2[C@@H](C)CCC[C@@H]2C)c1 |
| InChI | InChI=1S/C17H25N3O/c1-12-7-5-8-13(2)20(12)19-14(3)16-9-6-10-17(11-16)18-15(4)21/h6,9-13H,5,7-8H2,1-4H3,(H,18,21)/b19-14-/t12-,13-/m0/s1 |
| InChIKey | ICYXFEOBYMYULC-WCBKCDEZSA-N |
| XLogP | 3.63 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|