C27H42O5 — CID 78134661
3,9,14-trihydroxy-10,13-dimethyl-17-(6-methyl-4-oxoheptan-2-yl)-1,2,3,4,5,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one (PubChem CID 78134661) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol. Its IUPAC name is 3,9,14-trihydroxy-10,13-dimethyl-17-(6-methyl-4-oxoheptan-2-yl)-1,2,3,4,5,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one.
| Compound Name | 3,9,14-trihydroxy-10,13-dimethyl-17-(6-methyl-4-oxoheptan-2-yl)-1,2,3,4,5,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 78134661 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | 3,9,14-trihydroxy-10,13-dimethyl-17-(6-methyl-4-oxoheptan-2-yl)-1,2,3,4,5,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one |
| SMILES | CC(C)CC(=O)CC(C)C1CCC2(O)C3=CC(=O)C4CC(O)CCC4(C)C3(O)CCC12C |
| InChI | InChI=1S/C27H42O5/c1-16(2)12-19(29)13-17(3)20-7-9-26(31)23-15-22(30)21-14-18(28)6-8-24(21,4)27(23,32)11-10-25(20,26)5/h15-18,20-21,28,31-32H,6-14H2,1-5H3 |
| InChIKey | AOTGWHNOFVQHIU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |