C23H21F3N4O2 — CID 78137103
7-(3,5-dimethylpiperazin-1-yl)-3-[8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]chromen-2-one (PubChem CID 78137103) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 7-(3,5-dimethylpiperazin-1-yl)-3-[8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]chromen-2-one.
| Compound Name | 7-(3,5-dimethylpiperazin-1-yl)-3-[8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 78137103 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 7-(3,5-dimethylpiperazin-1-yl)-3-[8-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]chromen-2-one |
| SMILES | CC1CN(c2ccc3cc(-c4cn5cccc(C(F)(F)F)c5n4)c(=O)oc3c2)CC(C)N1 |
| InChI | InChI=1S/C23H21F3N4O2/c1-13-10-30(11-14(2)27-13)16-6-5-15-8-17(22(31)32-20(15)9-16)19-12-29-7-3-4-18(21(29)28-19)23(24,25)26/h3-9,12-14,27H,10-11H2,1-2H3 |
| InChIKey | RPNCAUKGJVOPFA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|