C22H21N5O2S — CID 7813840
(2R)-N-(2-cyanophenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 7813840) has the molecular formula C22H21N5O2S and a molecular weight of 419.51 g/mol. Its IUPAC name is (2R)-N-(2-cyanophenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-(2-cyanophenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7813840 |
| Molecular Formula | C22H21N5O2S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2R)-N-(2-cyanophenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)Nc2ccccc2C#N)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H21N5O2S/c1-4-13-27-20(16-9-11-18(29-3)12-10-16)25-26-22(27)30-15(2)21(28)24-19-8-6-5-7-17(19)14-23/h4-12,15H,1,13H2,2-3H3,(H,24,28)/t15-/m1/s1 |
| InChIKey | BRONQVFMRURZRS-OAHLLOKOSA-N |
| XLogP | 4.13 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|