C24H36N4O — CID 78150197
1-[[3-methyl-4-[(4-methyl-1H-benzimidazol-2-yl)methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3-propylurea (PubChem CID 78150197) has the molecular formula C24H36N4O and a molecular weight of 396.58 g/mol. Its IUPAC name is 1-[[3-methyl-4-[(4-methyl-1H-benzimidazol-2-yl)methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3-propylurea.
| Compound Name | 1-[[3-methyl-4-[(4-methyl-1H-benzimidazol-2-yl)methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3-propylurea |
|---|---|
| PubChem CID | 78150197 |
| Molecular Formula | C24H36N4O |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | 1-[[3-methyl-4-[(4-methyl-1H-benzimidazol-2-yl)methyl]-6-propan-2-ylcyclohex-2-en-1-yl]methyl]-3-propylurea |
| SMILES | CCCNC(=O)NCC1C=C(C)C(Cc2nc3c(C)cccc3[nH]2)CC1C(C)C |
| InChI | InChI=1S/C24H36N4O/c1-6-10-25-24(29)26-14-19-11-17(5)18(12-20(19)15(2)3)13-22-27-21-9-7-8-16(4)23(21)28-22/h7-9,11,15,18-20H,6,10,12-14H2,1-5H3,(H,27,28)(H2,25,26,29) |
| InChIKey | AFJXSLYBUVLNIE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|