C20H29N3O2S — CID 78150037
N-[[4-(1H-benzimidazol-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]methanesulfonamide (PubChem CID 78150037) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[[4-(1H-benzimidazol-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]methanesulfonamide.
| Compound Name | N-[[4-(1H-benzimidazol-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 78150037 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | N-[[4-(1H-benzimidazol-2-ylmethyl)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]methyl]methanesulfonamide |
| SMILES | CC1=CC(CNS(C)(=O)=O)C(C(C)C)CC1Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H29N3O2S/c1-13(2)17-10-15(14(3)9-16(17)12-21-26(4,24)25)11-20-22-18-7-5-6-8-19(18)23-20/h5-9,13,15-17,21H,10-12H2,1-4H3,(H,22,23) |
| InChIKey | VBLQAYFYJLLXRC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|