C28H35N3O3 — CID 78150235
methyl 2-[[4-[[(2-hydroxyphenyl)methylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-3H-benzimidazole-5-carboxylate (PubChem CID 78150235) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is methyl 2-[[4-[[(2-hydroxyphenyl)methylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-3H-benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[[4-[[(2-hydroxyphenyl)methylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 78150235 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | methyl 2-[[4-[[(2-hydroxyphenyl)methylamino]methyl]-2-methyl-5-propan-2-ylcyclohex-2-en-1-yl]methyl]-3H-benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(CC3CC(C(C)C)C(CNCc4ccccc4O)C=C3C)[nH]c2c1 |
| InChI | InChI=1S/C28H35N3O3/c1-17(2)23-12-21(14-27-30-24-10-9-19(28(33)34-4)13-25(24)31-27)18(3)11-22(23)16-29-15-20-7-5-6-8-26(20)32/h5-11,13,17,21-23,29,32H,12,14-16H2,1-4H3,(H,30,31) |
| InChIKey | SBUMKNRYCRABRJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|