About 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide
3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide (PubChem CID 78151055) has the molecular formula C22H24N4O4
and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide.
Molecular Properties
| Compound Name | 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide |
| PubChem CID | 78151055 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NC2C(c3ccc(N4CCOCC4)nc3)CC(O)C2O)c1 |
| InChI | InChI=1S/C22H24N4O4/c23-12-14-2-1-3-15(10-14)22(29)25-20-17(11-18(27)21(20)28)16-4-5-19(24-13-16)26-6-8-30-9-7-26/h1-5,10,13,17-18,20-21,27-28H,6-9,11H2,(H,25,29) |
| InChIKey | ZKGPKAQYOVDSFO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide?
The IUPAC name of 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide (CID 78151055) is 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide.
What is the SMILES notation for 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide?
The canonical SMILES for 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide is N#Cc1cccc(C(=O)NC2C(c3ccc(N4CCOCC4)nc3)CC(O)C2O)c1.
What is the InChIKey of 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide?
The InChIKey is ZKGPKAQYOVDSFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O4/c23-12-14-2-1-3-15(10-14)22(29)25-20-17(11-18(27)21(20)28)16-4-5-19(24-13-16)26-6-8-30-9-7-26/h1-5,10,13,17-18,20-21,27-28H,6-9,11H2,(H,25,29).
What are the key properties of 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide?
3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide has a molecular weight of 408.46 g/mol, XLogP of 0.80, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide is sourced from PubChem (CID 78151055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).