C22H24N4O4 — CID 78151055
3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide (PubChem CID 78151055) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide.
| Compound Name | 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 78151055 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 3-cyano-N-[2,3-dihydroxy-5-(6-morpholin-4-yl-3-pyridinyl)cyclopentyl]benzamide |
| SMILES | N#Cc1cccc(C(=O)NC2C(c3ccc(N4CCOCC4)nc3)CC(O)C2O)c1 |
| InChI | InChI=1S/C22H24N4O4/c23-12-14-2-1-3-15(10-14)22(29)25-20-17(11-18(27)21(20)28)16-4-5-19(24-13-16)26-6-8-30-9-7-26/h1-5,10,13,17-18,20-21,27-28H,6-9,11H2,(H,25,29) |
| InChIKey | ZKGPKAQYOVDSFO-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |