C18H17N3O3 — CID 75536066
4-cyano-N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide (PubChem CID 75536066) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 4-cyano-N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide.
| Compound Name | 4-cyano-N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide |
|---|---|
| PubChem CID | 75536066 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-cyano-N-[(1R,2S,3R,5R)-2,3-dihydroxy-5-pyridin-3-ylcyclopentyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)N[C@H]2[C@H](O)[C@H](O)C[C@@H]2c2cccnc2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c19-9-11-3-5-12(6-4-11)18(24)21-16-14(8-15(22)17(16)23)13-2-1-7-20-10-13/h1-7,10,14-17,22-23H,8H2,(H,21,24)/t14-,15-,16-,17-/m1/s1 |
| InChIKey | SZHLXVAXEREZIJ-QBPKDAKJSA-N |
| XLogP | 0.96 |
| TPSA | 106.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |